C26H37N7O3S — CID 11272496
(2S)-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(methylamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide (PubChem CID 11272496) has the molecular formula C26H37N7O3S and a molecular weight of 527.70 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(methylamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(methylamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11272496 |
| Molecular Formula | C26H37N7O3S |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | (2S)-N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[1-(methylamino)cyclohexanecarbonyl]pyrrolidine-2-carboxamide |
| SMILES | CNC1(C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCN=C(N)N)C(=O)c2nc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C26H37N7O3S/c1-29-26(13-5-2-6-14-26)24(36)33-16-8-11-19(33)22(35)31-18(10-7-15-30-25(27)28)21(34)23-32-17-9-3-4-12-20(17)37-23/h3-4,9,12,18-19,29H,2,5-8,10-11,13-16H2,1H3,(H,31,35)(H4,27,28,30)/t18-,19-/m0/s1 |
| InChIKey | PGNYFNNGKFDODI-OALUTQOASA-N |
| XLogP | 1.93 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|