C16H28N6O3 — CID 22854913
(2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 22854913) has the molecular formula C16H28N6O3 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22854913 |
| Molecular Formula | C16H28N6O3 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@@H](C=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C16H28N6O3/c17-16(18)20-8-1-4-11(10-23)21-14(24)13-6-3-9-22(13)15(25)12-5-2-7-19-12/h10-13,19H,1-9H2,(H,21,24)(H4,17,18,20)/t11-,12+,13-/m0/s1 |
| InChIKey | BGGWPINETKLZLE-XQQFMLRXSA-N |
| XLogP | -1.53 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|