C21H30N6O4 — CID 10369655
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 10369655) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10369655 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1Cc2ccccc2CN1)C(=O)O |
| InChI | InChI=1S/C21H30N6O4/c22-21(23)24-9-3-7-15(20(30)31)26-18(28)17-8-4-10-27(17)19(29)16-11-13-5-1-2-6-14(13)12-25-16/h1-2,5-6,15-17,25H,3-4,7-12H2,(H,26,28)(H,30,31)(H4,22,23,24)/t15-,16-,17-/m0/s1 |
| InChIKey | SUJIPEZCTCUCBH-ULQDDVLXSA-N |
| XLogP | -0.69 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|