C23H34Cl2N6O5 — CID 87216305
(2S)-2-[[(2S)-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-dichloropropan-2-one (PubChem CID 87216305) has the molecular formula C23H34Cl2N6O5 and a molecular weight of 545.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-dichloropropan-2-one.
| Compound Name | (2S)-2-[[(2S)-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-dichloropropan-2-one |
|---|---|
| PubChem CID | 87216305 |
| Molecular Formula | C23H34Cl2N6O5 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (2S)-2-[[(2S)-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-dichloropropan-2-one |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)C(N)Cc1ccccc1)C(=O)O.O=C(CCl)CCl |
| InChI | InChI=1S/C20H30N6O4.C3H4Cl2O/c21-14(12-13-6-2-1-3-7-13)18(28)26-11-5-9-16(26)17(27)25-15(19(29)30)8-4-10-24-20(22)23;4-1-3(6)2-5/h1-3,6-7,14-16H,4-5,8-12,21H2,(H,25,27)(H,29,30)(H4,22,23,24);1-2H2/t14?,15-,16-;/m0./s1 |
| InChIKey | QKYYGARSIQJMPN-CTIJFNHYSA-N |
| XLogP | 0.20 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|