C25H38N8O7 — CID 175720310
(2S)-2-[[(2S)-5-amino-2-[[(2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175720310) has the molecular formula C25H38N8O7 and a molecular weight of 562.63 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-amino-2-[[(2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-amino-2-[[(2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175720310 |
| Molecular Formula | C25H38N8O7 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | (2S)-2-[[(2S)-5-amino-2-[[(2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H38N8O7/c26-16(13-14-5-7-15(34)8-6-14)23(38)33-12-2-4-19(33)22(37)31-17(9-10-20(27)35)21(36)32-18(24(39)40)3-1-11-30-25(28)29/h5-8,16-19,34H,1-4,9-13,26H2,(H2,27,35)(H,31,37)(H,32,36)(H,39,40)(H4,28,29,30)/t16-,17-,18-,19-/m0/s1 |
| InChIKey | UPEJJORMTNFLBJ-VJANTYMQSA-N |
| XLogP | -2.37 |
| TPSA | 269.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|