C23H35N7O6 — CID 19950291
2-[[1-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19950291) has the molecular formula C23H35N7O6 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19950291 |
| Molecular Formula | C23H35N7O6 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 2-[[1-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H35N7O6/c1-13(28-19(32)16(24)12-14-6-8-15(31)9-7-14)21(34)30-11-3-5-18(30)20(33)29-17(22(35)36)4-2-10-27-23(25)26/h6-9,13,16-18,31H,2-5,10-12,24H2,1H3,(H,28,32)(H,29,33)(H,35,36)(H4,25,26,27) |
| InChIKey | ZBOMSOOLYIYMCL-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|