C23H35N7O6S — CID 18246171
2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18246171) has the molecular formula C23H35N7O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18246171 |
| Molecular Formula | C23H35N7O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)NC(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H35N7O6S/c24-15(3-1-9-27-23(25)26)21(34)30-10-2-4-18(30)20(33)29-17(12-37)19(32)28-16(22(35)36)11-13-5-7-14(31)8-6-13/h5-8,15-18,31,37H,1-4,9-12,24H2,(H,28,32)(H,29,33)(H,35,36)(H4,25,26,27) |
| InChIKey | CLZHVDDFWFLXQY-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|