C25H37N7O5 — CID 18246344
1-[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18246344) has the molecular formula C25H37N7O5 and a molecular weight of 515.62 g/mol. Its IUPAC name is 1-[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18246344 |
| Molecular Formula | C25H37N7O5 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 1-[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C25H37N7O5/c26-17(9-4-12-29-25(27)28)22(34)31-13-5-10-19(31)21(33)30-18(15-16-7-2-1-3-8-16)23(35)32-14-6-11-20(32)24(36)37/h1-3,7-8,17-20H,4-6,9-15,26H2,(H,30,33)(H,36,37)(H4,27,28,29) |
| InChIKey | FMXFMRWFCKRPGV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 197.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|