C22H35N7O3 — CID 169180644
(2S)-1-[(2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoyl]-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 169180644) has the molecular formula C22H35N7O3 and a molecular weight of 445.57 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoyl]-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoyl]-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169180644 |
| Molecular Formula | C22H35N7O3 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-5-[[amino(dimethylamino)methylidene]amino]pentanoyl]-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)/C(N)=N/CCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C22H35N7O3/c1-28(2)22(25)26-12-6-10-16(23)21(32)29-13-7-11-18(29)20(31)27-17(19(24)30)14-15-8-4-3-5-9-15/h3-5,8-9,16-18H,6-7,10-14,23H2,1-2H3,(H2,24,30)(H2,25,26)(H,27,31)/t16-,17-,18-/m0/s1 |
| InChIKey | RLVGSUYFFHCIEO-BZSNNMDCSA-N |
| XLogP | -0.83 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|