C24H37N7O6 — CID 18246402
2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18246402) has the molecular formula C24H37N7O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18246402 |
| Molecular Formula | C24H37N7O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(O)C(NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H37N7O6/c1-14(32)19(21(34)29-17(23(36)37)13-15-7-3-2-4-8-15)30-20(33)18-10-6-12-31(18)22(35)16(25)9-5-11-28-24(26)27/h2-4,7-8,14,16-19,32H,5-6,9-13,25H2,1H3,(H,29,34)(H,30,33)(H,36,37)(H4,26,27,28) |
| InChIKey | UBZMJHPRAPPZQN-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|