C29H39N7O5 — CID 18245950
1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18245950) has the molecular formula C29H39N7O5 and a molecular weight of 565.68 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18245950 |
| Molecular Formula | C29H39N7O5 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C29H39N7O5/c30-21(13-7-15-33-29(31)32)25(37)34-22(17-19-9-3-1-4-10-19)26(38)35-23(18-20-11-5-2-6-12-20)27(39)36-16-8-14-24(36)28(40)41/h1-6,9-12,21-24H,7-8,13-18,30H2,(H,34,37)(H,35,38)(H,40,41)(H4,31,32,33) |
| InChIKey | BFUXTJDBBYSROX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|