C22H33N7O5 — CID 18485411
1-[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18485411) has the molecular formula C22H33N7O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 1-[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18485411 |
| Molecular Formula | C22H33N7O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 1-[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C22H33N7O5/c23-13-18(30)27-15(8-4-10-26-22(24)25)19(31)28-16(12-14-6-2-1-3-7-14)20(32)29-11-5-9-17(29)21(33)34/h1-3,6-7,15-17H,4-5,8-13,23H2,(H,27,30)(H,28,31)(H,33,34)(H4,24,25,26) |
| InChIKey | QNLDYQYSMBTJQL-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|