C17H30N8O6 — CID 18485195
1-[4-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18485195) has the molecular formula C17H30N8O6 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-[4-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18485195 |
| Molecular Formula | C17H30N8O6 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-[4-amino-2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C17H30N8O6/c18-8-13(27)23-9(3-1-5-22-17(20)21)14(28)24-10(7-12(19)26)15(29)25-6-2-4-11(25)16(30)31/h9-11H,1-8,18H2,(H2,19,26)(H,23,27)(H,24,28)(H,30,31)(H4,20,21,22) |
| InChIKey | BCZULIZQSILSKY-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 249.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|