C22H33N7O6 — CID 18491868
1-[2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18491868) has the molecular formula C22H33N7O6 and a molecular weight of 491.55 g/mol. Its IUPAC name is 1-[2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18491868 |
| Molecular Formula | C22H33N7O6 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 1-[2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCC(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C22H33N7O6/c23-12-18(31)27-16(11-13-5-7-14(30)8-6-13)19(32)28-15(3-1-9-26-22(24)25)20(33)29-10-2-4-17(29)21(34)35/h5-8,15-17,30H,1-4,9-12,23H2,(H,27,31)(H,28,32)(H,34,35)(H4,24,25,26) |
| InChIKey | AWCXMECSDXSLAP-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|