C26H42N10O6 — CID 22651319
1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22651319) has the molecular formula C26H42N10O6 and a molecular weight of 590.69 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22651319 |
| Molecular Formula | C26H42N10O6 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C26H42N10O6/c27-17(4-1-11-32-25(28)29)21(38)35-19(14-15-7-9-16(37)10-8-15)22(39)34-18(5-2-12-33-26(30)31)23(40)36-13-3-6-20(36)24(41)42/h7-10,17-20,37H,1-6,11-14,27H2,(H,34,39)(H,35,38)(H,41,42)(H4,28,29,32)(H4,30,31,33) |
| InChIKey | UAIFAPXIWLFBMD-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 290.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|