C26H37N9O6 — CID 19953218
1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 19953218) has the molecular formula C26H37N9O6 and a molecular weight of 571.64 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19953218 |
| Molecular Formula | C26H37N9O6 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C26H37N9O6/c27-18(11-15-5-7-17(36)8-6-15)22(37)34-20(12-16-13-30-14-32-16)23(38)33-19(3-1-9-31-26(28)29)24(39)35-10-2-4-21(35)25(40)41/h5-8,13-14,18-21,36H,1-4,9-12,27H2,(H,30,32)(H,33,38)(H,34,37)(H,40,41)(H4,28,29,31) |
| InChIKey | DKHJYSRSYIPQAR-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 255.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|