C25H37N7O8 — CID 19952038
1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 19952038) has the molecular formula C25H37N7O8 and a molecular weight of 563.61 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19952038 |
| Molecular Formula | C25H37N7O8 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 1-[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C25H37N7O8/c26-16(13-14-5-7-15(33)8-6-14)21(36)30-17(9-10-20(34)35)22(37)31-18(3-1-11-29-25(27)28)23(38)32-12-2-4-19(32)24(39)40/h5-8,16-19,33H,1-4,9-13,26H2,(H,30,36)(H,31,37)(H,34,35)(H,39,40)(H4,27,28,29) |
| InChIKey | OCIUPQONQAVLDE-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 263.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|