C21H35N7O9 — CID 18242621
1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18242621) has the molecular formula C21H35N7O9 and a molecular weight of 529.55 g/mol. Its IUPAC name is 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18242621 |
| Molecular Formula | C21H35N7O9 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C21H35N7O9/c22-11(3-1-9-25-21(23)24)17(33)26-12(5-7-15(29)30)18(34)27-13(6-8-16(31)32)19(35)28-10-2-4-14(28)20(36)37/h11-14H,1-10,22H2,(H,26,33)(H,27,34)(H,29,30)(H,31,32)(H,36,37)(H4,23,24,25) |
| InChIKey | PAWDAFAKSRLWDO-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 280.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|