C20H34N8O8 — CID 18263286
1-[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18263286) has the molecular formula C20H34N8O8 and a molecular weight of 514.54 g/mol. Its IUPAC name is 1-[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18263286 |
| Molecular Formula | C20H34N8O8 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 1-[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C20H34N8O8/c21-10(5-6-15(30)31)16(32)27-12(9-14(22)29)17(33)26-11(3-1-7-25-20(23)24)18(34)28-8-2-4-13(28)19(35)36/h10-13H,1-9,21H2,(H2,22,29)(H,26,33)(H,27,32)(H,30,31)(H,35,36)(H4,23,24,25) |
| InChIKey | AYBONAFQVPGRIX-UHFFFAOYSA-N |
| XLogP | -3.85 |
| TPSA | 286.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|