C22H40N8O6 — CID 18480790
1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18480790) has the molecular formula C22H40N8O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18480790 |
| Molecular Formula | C22H40N8O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C22H40N8O6/c1-12(2)11-15(29-18(32)13(23)7-8-17(24)31)19(33)28-14(5-3-9-27-22(25)26)20(34)30-10-4-6-16(30)21(35)36/h12-16H,3-11,23H2,1-2H3,(H2,24,31)(H,28,33)(H,29,32)(H,35,36)(H4,25,26,27) |
| InChIKey | YFRVXHPAKZBULF-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 249.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|