C19H34N8O6 — CID 18242920
1-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18242920) has the molecular formula C19H34N8O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18242920 |
| Molecular Formula | C19H34N8O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 1-[2-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C19H34N8O6/c1-10(17(31)27-9-3-5-13(27)18(32)33)25-16(30)12(6-7-14(21)28)26-15(29)11(20)4-2-8-24-19(22)23/h10-13H,2-9,20H2,1H3,(H2,21,28)(H,25,30)(H,26,29)(H,32,33)(H4,22,23,24) |
| InChIKey | HDNOWPCIHVQQEC-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 249.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|