C18H31N7O7 — CID 18246919
1-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18246919) has the molecular formula C18H31N7O7 and a molecular weight of 457.49 g/mol. Its IUPAC name is 1-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18246919 |
| Molecular Formula | C18H31N7O7 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C18H31N7O7/c1-9(16(30)25-7-3-5-12(25)17(31)32)23-15(29)11(4-2-6-22-18(20)21)24-14(28)10(19)8-13(26)27/h9-12H,2-8,19H2,1H3,(H,23,29)(H,24,28)(H,26,27)(H,31,32)(H4,20,21,22) |
| InChIKey | XKHAOICQODFMPU-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|