C23H43N9O6 — CID 175769206
(2S)-1-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 175769206) has the molecular formula C23H43N9O6 and a molecular weight of 541.65 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175769206 |
| Molecular Formula | C23H43N9O6 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C23H43N9O6/c1-13(25)18(33)30-16(8-5-11-28-23(26)27)20(35)31-15(7-3-4-10-24)19(34)29-14(2)21(36)32-12-6-9-17(32)22(37)38/h13-17H,3-12,24-25H2,1-2H3,(H,29,34)(H,30,33)(H,31,35)(H,37,38)(H4,26,27,28)/t13-,14-,15-,16-,17-/m0/s1 |
| InChIKey | ASFCWCHDSDIZQK-WOYTXXSLSA-N |
| XLogP | -2.93 |
| TPSA | 261.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|