C17H31N7O5S — CID 18233070
1-[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18233070) has the molecular formula C17H31N7O5S and a molecular weight of 445.55 g/mol. Its IUPAC name is 1-[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18233070 |
| Molecular Formula | C17H31N7O5S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C17H31N7O5S/c1-9(18)13(25)22-10(4-2-6-21-17(19)20)14(26)23-11(8-30)15(27)24-7-3-5-12(24)16(28)29/h9-12,30H,2-8,18H2,1H3,(H,22,25)(H,23,26)(H,28,29)(H4,19,20,21) |
| InChIKey | QHMOJITWAZWLNB-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|