C22H41N9O6 — CID 18302846
1-[5-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18302846) has the molecular formula C22H41N9O6 and a molecular weight of 527.63 g/mol. Its IUPAC name is 1-[5-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[5-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18302846 |
| Molecular Formula | C22H41N9O6 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 1-[5-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C22H41N9O6/c23-10-2-1-5-13(24)18(33)29-14(6-3-11-28-22(26)27)19(34)30-15(8-9-17(25)32)20(35)31-12-4-7-16(31)21(36)37/h13-16H,1-12,23-24H2,(H2,25,32)(H,29,33)(H,30,34)(H,36,37)(H4,26,27,28) |
| InChIKey | HLFYONFPBBYMED-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 275.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|