C22H43N9O4 — CID 155258976
2-amino-N-[6-amino-1-[[5-(diaminomethylideneamino)-1-(2-methylpyrrolidin-1-yl)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide (PubChem CID 155258976) has the molecular formula C22H43N9O4 and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-amino-N-[6-amino-1-[[5-(diaminomethylideneamino)-1-(2-methylpyrrolidin-1-yl)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide.
| Compound Name | 2-amino-N-[6-amino-1-[[5-(diaminomethylideneamino)-1-(2-methylpyrrolidin-1-yl)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 155258976 |
| Molecular Formula | C22H43N9O4 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | 2-amino-N-[6-amino-1-[[5-(diaminomethylideneamino)-1-(2-methylpyrrolidin-1-yl)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]pentanediamide |
| SMILES | CC1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(N)CCC(N)=O |
| InChI | InChI=1S/C22H43N9O4/c1-14-6-5-13-31(14)21(35)17(8-4-12-28-22(26)27)30-20(34)16(7-2-3-11-23)29-19(33)15(24)9-10-18(25)32/h14-17H,2-13,23-24H2,1H3,(H2,25,32)(H,29,33)(H,30,34)(H4,26,27,28) |
| InChIKey | FTOMGCXRGPMUJN-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 238.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|