C23H45N9O5 — CID 18302943
1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18302943) has the molecular formula C23H45N9O5 and a molecular weight of 527.67 g/mol. Its IUPAC name is 1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18302943 |
| Molecular Formula | C23H45N9O5 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | 1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C23H45N9O5/c24-11-3-1-7-15(26)19(33)30-16(9-5-13-29-23(27)28)20(34)31-17(8-2-4-12-25)21(35)32-14-6-10-18(32)22(36)37/h15-18H,1-14,24-26H2,(H,30,33)(H,31,34)(H,36,37)(H4,27,28,29) |
| InChIKey | SYISUGQMZXWCPM-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 258.27 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|