C21H39N9O6 — CID 22652710
1-[6-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22652710) has the molecular formula C21H39N9O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is 1-[6-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[6-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22652710 |
| Molecular Formula | C21H39N9O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 1-[6-amino-2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C21H39N9O6/c22-8-2-1-5-14(19(34)30-10-4-7-15(30)20(35)36)29-18(33)13(6-3-9-27-21(25)26)28-17(32)12(23)11-16(24)31/h12-15H,1-11,22-23H2,(H2,24,31)(H,28,32)(H,29,33)(H,35,36)(H4,25,26,27) |
| InChIKey | IWSWMDIIMCMYFL-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 275.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|