C21H38N8O6S — CID 18481589
1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylsulfanylbutanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18481589) has the molecular formula C21H38N8O6S and a molecular weight of 530.65 g/mol. Its IUPAC name is 1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylsulfanylbutanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylsulfanylbutanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18481589 |
| Molecular Formula | C21H38N8O6S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 1-[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylsulfanylbutanoyl]amino]pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CSCCC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C21H38N8O6S/c1-36-11-8-13(27-17(31)12(22)6-7-16(23)30)18(32)28-14(4-2-9-26-21(24)25)19(33)29-10-3-5-15(29)20(34)35/h12-15H,2-11,22H2,1H3,(H2,23,30)(H,27,31)(H,28,32)(H,34,35)(H4,24,25,26) |
| InChIKey | LTUCXGVCRKQKGA-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 249.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|