C24H36N8O7 — CID 19950840
1-[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 19950840) has the molecular formula C24H36N8O7 and a molecular weight of 548.60 g/mol. Its IUPAC name is 1-[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19950840 |
| Molecular Formula | C24H36N8O7 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 1-[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C24H36N8O7/c25-15(11-13-5-7-14(33)8-6-13)20(35)31-17(12-19(26)34)21(36)30-16(3-1-9-29-24(27)28)22(37)32-10-2-4-18(32)23(38)39/h5-8,15-18,33H,1-4,9-12,25H2,(H2,26,34)(H,30,36)(H,31,35)(H,38,39)(H4,27,28,29) |
| InChIKey | QKIFLSOVORTDCG-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 269.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|