C22H31FN6O5 — CID 135315656
[1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid (PubChem CID 135315656) has the molecular formula C22H31FN6O5 and a molecular weight of 478.53 g/mol. Its IUPAC name is [1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | [1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135315656 |
| Molecular Formula | C22H31FN6O5 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [1-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
| SMILES | NC(N)=NCCCC(NC(=O)[C@@H]1CCCN1C(=O)C(Cc1ccccc1)NC(=O)O)C(=O)CF |
| InChI | InChI=1S/C22H31FN6O5/c23-13-18(30)15(8-4-10-26-21(24)25)27-19(31)17-9-5-11-29(17)20(32)16(28-22(33)34)12-14-6-2-1-3-7-14/h1-3,6-7,15-17,28H,4-5,8-13H2,(H,27,31)(H,33,34)(H4,24,25,26)/t15?,16?,17-/m0/s1 |
| InChIKey | FLMCOGCNDXAKKD-JCYILVPMSA-N |
| XLogP | -0.07 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|