C26H40N6O6 — CID 134826542
methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoate (PubChem CID 134826542) has the molecular formula C26H40N6O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 134826542 |
| Molecular Formula | C26H40N6O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40N6O6/c1-26(2,3)38-25(36)31-19(16-17-10-6-5-7-11-17)22(34)32-15-9-13-20(32)21(33)30-18(23(35)37-4)12-8-14-29-24(27)28/h5-7,10-11,18-20H,8-9,12-16H2,1-4H3,(H,30,33)(H,31,36)(H4,27,28,29)/t18-,19+,20-/m0/s1 |
| InChIKey | BETBNGUVUFTEGR-ZCNNSNEGSA-N |
| XLogP | 0.82 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|