C25H38N6O6 — CID 54077162
benzyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoate (PubChem CID 54077162) has the molecular formula C25H38N6O6 and a molecular weight of 518.62 g/mol. Its IUPAC name is benzyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoate.
| Compound Name | benzyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 54077162 |
| Molecular Formula | C25H38N6O6 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | benzyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H38N6O6/c1-25(2,3)37-24(35)29-15-20(32)31-14-8-12-19(31)21(33)30-18(11-7-13-28-23(26)27)22(34)36-16-17-9-5-4-6-10-17/h4-6,9-10,18-19H,7-8,11-16H2,1-3H3,(H,29,35)(H,30,33)(H4,26,27,28)/t18-,19-/m0/s1 |
| InChIKey | MKMXXQMBNAAMFQ-OALUTQOASA-N |
| XLogP | 0.78 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|