C23H34N6O4S — CID 5288787
(2S)-N-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]-1-[(2R)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]pyrrolidine-2-carboxamide (PubChem CID 5288787) has the molecular formula C23H34N6O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]-1-[(2R)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]-1-[(2R)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5288787 |
| Molecular Formula | C23H34N6O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (2S)-N-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]-1-[(2R)-3-phenyl-2-[(2-sulfanylacetyl)amino]propanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)CS |
| InChI | InChI=1S/C23H34N6O4S/c1-15(30)17(9-5-11-26-23(24)25)28-21(32)19-10-6-12-29(19)22(33)18(27-20(31)14-34)13-16-7-3-2-4-8-16/h2-4,7-8,17-19,34H,5-6,9-14H2,1H3,(H,27,31)(H,28,32)(H4,24,25,26)/t17-,18+,19-/m0/s1 |
| InChIKey | UAQYMAQZCKKYIX-OTWHNJEPSA-N |
| XLogP | -0.24 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|