C29H37N7O6 — CID 139917442
4-amino-2-[(2S)-2-[[(2S)-1-[(2S)-2-[(2-deuterioacetyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]benzoic acid (PubChem CID 139917442) has the molecular formula C29H37N7O6 and a molecular weight of 580.66 g/mol. Its IUPAC name is 4-amino-2-[(2S)-2-[[(2S)-1-[(2S)-2-[(2-deuterioacetyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]benzoic acid.
| Compound Name | 4-amino-2-[(2S)-2-[[(2S)-1-[(2S)-2-[(2-deuterioacetyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]benzoic acid |
|---|---|
| PubChem CID | 139917442 |
| Molecular Formula | C29H37N7O6 |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 4-amino-2-[(2S)-2-[[(2S)-1-[(2S)-2-[(2-deuterioacetyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]benzoic acid |
| SMILES | [2H]CC(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1cc(N)ccc1C(=O)O |
| InChI | InChI=1S/C29H37N7O6/c1-17(37)34-23(15-18-7-3-2-4-8-18)27(40)36-14-6-10-24(36)26(39)35-22(9-5-13-33-29(31)32)25(38)21-16-19(30)11-12-20(21)28(41)42/h2-4,7-8,11-12,16,22-24H,5-6,9-10,13-15,30H2,1H3,(H,34,37)(H,35,39)(H,41,42)(H4,31,32,33)/t22-,23-,24-/m0/s1/i1D |
| InChIKey | GGFVCENEHDGROJ-PHROTQFJSA-N |
| XLogP | 0.43 |
| TPSA | 223.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|