C30H51N7O4 — CID 143925178
N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-(heptanoylamino)-3-phenylpropanoyl]piperidine-2-carboxamide;ethane (PubChem CID 143925178) has the molecular formula C30H51N7O4 and a molecular weight of 573.78 g/mol. Its IUPAC name is N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-(heptanoylamino)-3-phenylpropanoyl]piperidine-2-carboxamide;ethane.
| Compound Name | N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-(heptanoylamino)-3-phenylpropanoyl]piperidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143925178 |
| Molecular Formula | C30H51N7O4 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.40 |
| IUPAC Name | N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-(heptanoylamino)-3-phenylpropanoyl]piperidine-2-carboxamide;ethane |
| SMILES | CC.CCCCCCC(=O)NC(Cc1ccccc1)C(=O)N1CCCCC1C(=O)NC(CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C28H45N7O4.C2H6/c1-2-3-4-8-16-24(36)33-22(19-20-12-6-5-7-13-20)27(39)35-18-10-9-15-23(35)26(38)34-21(25(29)37)14-11-17-32-28(30)31;1-2/h5-7,12-13,21-23H,2-4,8-11,14-19H2,1H3,(H2,29,37)(H,33,36)(H,34,38)(H4,30,31,32);1-2H3 |
| InChIKey | GSZWRXYRIFWJFV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|