C20H28FN7O5 — CID 135315281
[2-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxo-1-pyridin-3-ylethyl]carbamic acid (PubChem CID 135315281) has the molecular formula C20H28FN7O5 and a molecular weight of 465.49 g/mol. Its IUPAC name is [2-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxo-1-pyridin-3-ylethyl]carbamic acid.
| Compound Name | [2-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxo-1-pyridin-3-ylethyl]carbamic acid |
|---|---|
| PubChem CID | 135315281 |
| Molecular Formula | C20H28FN7O5 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | [2-[(2S)-2-[[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxo-1-pyridin-3-ylethyl]carbamic acid |
| SMILES | NC(N)=NCCCC(NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)O)c1cccnc1)C(=O)CF |
| InChI | InChI=1S/C20H28FN7O5/c21-10-15(29)13(5-2-8-25-19(22)23)26-17(30)14-6-3-9-28(14)18(31)16(27-20(32)33)12-4-1-7-24-11-12/h1,4,7,11,13-14,16,27H,2-3,5-6,8-10H2,(H,26,30)(H,32,33)(H4,22,23,25)/t13?,14-,16?/m0/s1 |
| InChIKey | XJRJBWFWSLKZAY-BBBYJDLNSA-N |
| XLogP | -0.54 |
| TPSA | 193.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|