C23H34BrFN6O5S — CID 154984638
(2S)-1-[2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 154984638) has the molecular formula C23H34BrFN6O5S and a molecular weight of 605.53 g/mol. Its IUPAC name is (2S)-1-[2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154984638 |
| Molecular Formula | C23H34BrFN6O5S |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | (2S)-1-[2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Br)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C23H34BrFN6O5S/c1-14(2)20(30-37(35,36)16-9-7-15(24)8-10-16)22(34)31-12-4-6-18(31)21(33)29-17(19(32)13-25)5-3-11-28-23(26)27/h7-10,14,17-18,20,30H,3-6,11-13H2,1-2H3,(H,29,33)(H4,26,27,28)/t17-,18-,20?/m0/s1 |
| InChIKey | IWSXGPZKKCKJCG-IJXZTRCJSA-N |
| XLogP | 0.82 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|