C28H37FN6O4 — CID 135315109
(2S)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]pyrrolidine-2-carboxamide (PubChem CID 135315109) has the molecular formula C28H37FN6O4 and a molecular weight of 540.64 g/mol. Its IUPAC name is (2S)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135315109 |
| Molecular Formula | C28H37FN6O4 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (2S)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1cccc2ccccc12)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C28H37FN6O4/c1-17(2)24(34-25(37)20-11-5-9-18-8-3-4-10-19(18)20)27(39)35-15-7-13-22(35)26(38)33-21(23(36)16-29)12-6-14-32-28(30)31/h3-5,8-11,17,21-22,24H,6-7,12-16H2,1-2H3,(H,33,38)(H,34,37)(H4,30,31,32)/t21?,22-,24?/m0/s1 |
| InChIKey | KXKJCINFNPNEIJ-MHIUNMELSA-N |
| XLogP | 1.66 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|