C24H33BrF2N6O4 — CID 155418297
(2S)-1-[2-[(4-bromo-3-fluorobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 155418297) has the molecular formula C24H33BrF2N6O4 and a molecular weight of 587.47 g/mol. Its IUPAC name is (2S)-1-[2-[(4-bromo-3-fluorobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(4-bromo-3-fluorobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155418297 |
| Molecular Formula | C24H33BrF2N6O4 |
| Molecular Weight | 587.47 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | (2S)-1-[2-[(4-bromo-3-fluorobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Br)c(F)c1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C24H33BrF2N6O4/c1-13(2)20(32-21(35)14-7-8-15(25)16(27)11-14)23(37)33-10-4-6-18(33)22(36)31-17(19(34)12-26)5-3-9-30-24(28)29/h7-8,11,13,17-18,20H,3-6,9-10,12H2,1-2H3,(H,31,36)(H,32,35)(H4,28,29,30)/t17-,18-,20?/m0/s1 |
| InChIKey | CNIPBNCMIQNMEY-IJXZTRCJSA-N |
| XLogP | 1.41 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|