C26H36FN7O4 — CID 154984687
(2S)-1-[(2S)-2-[(3-cyano-4-methylbenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 154984687) has the molecular formula C26H36FN7O4 and a molecular weight of 529.62 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(3-cyano-4-methylbenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[(3-cyano-4-methylbenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154984687 |
| Molecular Formula | C26H36FN7O4 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (2S)-1-[(2S)-2-[(3-cyano-4-methylbenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF)C(C)C)cc1C#N |
| InChI | InChI=1S/C26H36FN7O4/c1-15(2)22(33-23(36)17-9-8-16(3)18(12-17)14-28)25(38)34-11-5-7-20(34)24(37)32-19(21(35)13-27)6-4-10-31-26(29)30/h8-9,12,15,19-20,22H,4-7,10-11,13H2,1-3H3,(H,32,37)(H,33,36)(H4,29,30,31)/t19-,20-,22-/m0/s1 |
| InChIKey | OJFJYUOMJNWWGC-ONTIZHBOSA-N |
| XLogP | 0.69 |
| TPSA | 183.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|