C25H35ClFN7O4 — CID 154984640
(2S)-1-[(2S)-2-[(4-chloro-3-cyanobenzoyl)amino]-1-hydroxy-3-methylbutyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 154984640) has the molecular formula C25H35ClFN7O4 and a molecular weight of 552.05 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(4-chloro-3-cyanobenzoyl)amino]-1-hydroxy-3-methylbutyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[(4-chloro-3-cyanobenzoyl)amino]-1-hydroxy-3-methylbutyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154984640 |
| Molecular Formula | C25H35ClFN7O4 |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | (2S)-1-[(2S)-2-[(4-chloro-3-cyanobenzoyl)amino]-1-hydroxy-3-methylbutyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)c(C#N)c1)C(O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C25H35ClFN7O4/c1-14(2)21(33-22(36)15-7-8-17(26)16(11-15)13-28)24(38)34-10-4-6-19(34)23(37)32-18(20(35)12-27)5-3-9-31-25(29)30/h7-8,11,14,18-19,21,24,38H,3-6,9-10,12H2,1-2H3,(H,32,37)(H,33,36)(H4,29,30,31)/t18-,19-,21-,24?/m0/s1 |
| InChIKey | YFXKZJUNEPKMHQ-ARDQPTDVSA-N |
| XLogP | 0.83 |
| TPSA | 186.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|