C24H35FN6O4 — CID 135315127
(2S)-1-(2-benzamido-3-methylbutanoyl)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 135315127) has the molecular formula C24H35FN6O4 and a molecular weight of 490.58 g/mol. Its IUPAC name is (2S)-1-(2-benzamido-3-methylbutanoyl)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-benzamido-3-methylbutanoyl)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135315127 |
| Molecular Formula | C24H35FN6O4 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (2S)-1-(2-benzamido-3-methylbutanoyl)-N-[6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C24H35FN6O4/c1-15(2)20(30-21(33)16-8-4-3-5-9-16)23(35)31-13-7-11-18(31)22(34)29-17(19(32)14-25)10-6-12-28-24(26)27/h3-5,8-9,15,17-18,20H,6-7,10-14H2,1-2H3,(H,29,34)(H,30,33)(H4,26,27,28)/t17?,18-,20?/m0/s1 |
| InChIKey | SPARKPSGLQLGLM-FDYSRKEFSA-N |
| XLogP | 0.51 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|