C21H31ClN6O3 — CID 132993002
(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]-N-[(3S)-1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 132993002) has the molecular formula C21H31ClN6O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-3-phenylpropanoyl]-N-[(3S)-1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-amino-3-phenylpropanoyl]-N-[(3S)-1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 132993002 |
| Molecular Formula | C21H31ClN6O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-3-phenylpropanoyl]-N-[(3S)-1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | NN/C=N/CCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)Cc1ccccc1)C(=O)CCl |
| InChI | InChI=1S/C21H31ClN6O3/c22-13-19(29)17(8-4-10-25-14-26-24)27-20(30)18-9-5-11-28(18)21(31)16(23)12-15-6-2-1-3-7-15/h1-3,6-7,14,16-18H,4-5,8-13,23-24H2,(H,25,26)(H,27,30)/t16-,17+,18+/m1/s1 |
| InChIKey | FVKLMZKESRSONY-SQNIBIBYSA-N |
| XLogP | 0.11 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|