C21H38N6O3 — CID 15341983
(2S)-1-[3-cyclohexyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 15341983) has the molecular formula C21H38N6O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2S)-1-[3-cyclohexyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[3-cyclohexyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 15341983 |
| Molecular Formula | C21H38N6O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (2S)-1-[3-cyclohexyl-3-(methylamino)propanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CNC(CC(=O)N1CCC[C@H]1C(=O)N[C@H](C=O)CCCN=C(N)N)C1CCCCC1 |
| InChI | InChI=1S/C21H38N6O3/c1-24-17(15-7-3-2-4-8-15)13-19(29)27-12-6-10-18(27)20(30)26-16(14-28)9-5-11-25-21(22)23/h14-18,24H,2-13H2,1H3,(H,26,30)(H4,22,23,25)/t16-,17?,18-/m0/s1 |
| InChIKey | YXQDQFIKBMGSMS-RGBJRUIASA-N |
| XLogP | 0.27 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|