C22H32N6O3 — CID 163772219
(2S)-1-(2-benzylazetidine-2-carbonyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 163772219) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is (2S)-1-(2-benzylazetidine-2-carbonyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-benzylazetidine-2-carbonyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163772219 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (2S)-1-(2-benzylazetidine-2-carbonyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@@H](C=O)NC(=O)[C@@H]1CCCN1C(=O)C1(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C22H32N6O3/c23-21(24)25-11-4-8-17(15-29)27-19(30)18-9-5-13-28(18)20(31)22(10-12-26-22)14-16-6-2-1-3-7-16/h1-3,6-7,15,17-18,26H,4-5,8-14H2,(H,27,30)(H4,23,24,25)/t17-,18-,22?/m0/s1 |
| InChIKey | MHKMEYRKQRGJMK-KJMDXERQSA-N |
| XLogP | -0.31 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|