C25H34BrFN4O4 — CID 160900760
2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(4-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]azetidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine (PubChem CID 160900760) has the molecular formula C25H34BrFN4O4 and a molecular weight of 553.47 g/mol. Its IUPAC name is 2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(4-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]azetidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine.
| Compound Name | 2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(4-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]azetidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine |
|---|---|
| PubChem CID | 160900760 |
| Molecular Formula | C25H34BrFN4O4 |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(4-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]azetidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine |
| SMILES | CC(C)[C@H](CC(=O)c1ccc(Br)cc1)C(=O)N1CC[C@H]1C(=O)C[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C25H34BrFN4O4/c1-15(2)19(13-21(32)16-5-7-18(26)8-6-16)24(35)31-11-9-20(31)22(33)12-17(23(34)14-27)4-3-10-30-25(28)29/h5-8,15,17,19-20H,3-4,9-14H2,1-2H3,(H4,28,29,30)/t17-,19+,20+/m1/s1 |
| InChIKey | UQGNBZUQAPUUIR-HOJAQTOUSA-N |
| XLogP | 3.06 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|