C26H38BrN5O5 — CID 159398624
4-bromo-N-[(2S)-1-[(2S,4R)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]-4-hydroxypyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 159398624) has the molecular formula C26H38BrN5O5 and a molecular weight of 580.52 g/mol. Its IUPAC name is 4-bromo-N-[(2S)-1-[(2S,4R)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]-4-hydroxypyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-bromo-N-[(2S)-1-[(2S,4R)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]-4-hydroxypyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 159398624 |
| Molecular Formula | C26H38BrN5O5 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 4-bromo-N-[(2S)-1-[(2S,4R)-2-[(3R)-3-[3-(diaminomethylideneamino)propyl]-4-oxohexanoyl]-4-hydroxypyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](NC(=O)c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C26H38BrN5O5/c1-4-21(34)17(6-5-11-30-26(28)29)12-22(35)20-13-19(33)14-32(20)25(37)23(15(2)3)31-24(36)16-7-9-18(27)10-8-16/h7-10,15,17,19-20,23,33H,4-6,11-14H2,1-3H3,(H,31,36)(H4,28,29,30)/t17-,19-,20+,23+/m1/s1 |
| InChIKey | SWHNPNUMMZYNCM-DBBLALLESA-N |
| XLogP | 1.77 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|