C26H36BrFN4O4 — CID 157482634
2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(3-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine (PubChem CID 157482634) has the molecular formula C26H36BrFN4O4 and a molecular weight of 567.50 g/mol. Its IUPAC name is 2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(3-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine.
| Compound Name | 2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(3-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine |
|---|---|
| PubChem CID | 157482634 |
| Molecular Formula | C26H36BrFN4O4 |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 2-[(4R)-4-[2-[(2S)-1-[(2S)-4-(3-bromophenyl)-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-6-fluoro-5-oxohexyl]guanidine |
| SMILES | CC(C)[C@H](CC(=O)c1cccc(Br)c1)C(=O)N1CCC[C@H]1C(=O)C[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C26H36BrFN4O4/c1-16(2)20(14-22(33)17-6-3-8-19(27)12-17)25(36)32-11-5-9-21(32)23(34)13-18(24(35)15-28)7-4-10-31-26(29)30/h3,6,8,12,16,18,20-21H,4-5,7,9-11,13-15H2,1-2H3,(H4,29,30,31)/t18-,20+,21+/m1/s1 |
| InChIKey | BWIJPBFPUJNULT-GIVPXCGWSA-N |
| XLogP | 3.45 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|