C29H38FN5O4 — CID 153027019
2-[(4R)-6-fluoro-4-[2-[(2S)-1-[(2S)-4-isoquinolin-6-yl-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-5-oxohexyl]guanidine (PubChem CID 153027019) has the molecular formula C29H38FN5O4 and a molecular weight of 539.65 g/mol. Its IUPAC name is 2-[(4R)-6-fluoro-4-[2-[(2S)-1-[(2S)-4-isoquinolin-6-yl-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-5-oxohexyl]guanidine.
| Compound Name | 2-[(4R)-6-fluoro-4-[2-[(2S)-1-[(2S)-4-isoquinolin-6-yl-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-5-oxohexyl]guanidine |
|---|---|
| PubChem CID | 153027019 |
| Molecular Formula | C29H38FN5O4 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 2-[(4R)-6-fluoro-4-[2-[(2S)-1-[(2S)-4-isoquinolin-6-yl-4-oxo-2-propan-2-ylbutanoyl]pyrrolidin-2-yl]-2-oxoethyl]-5-oxohexyl]guanidine |
| SMILES | CC(C)[C@H](CC(=O)c1ccc2cnccc2c1)C(=O)N1CCC[C@H]1C(=O)C[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C29H38FN5O4/c1-18(2)23(15-25(36)21-7-8-22-17-33-11-9-19(22)13-21)28(39)35-12-4-6-24(35)26(37)14-20(27(38)16-30)5-3-10-34-29(31)32/h7-9,11,13,17-18,20,23-24H,3-6,10,12,14-16H2,1-2H3,(H4,31,32,34)/t20-,23+,24+/m1/s1 |
| InChIKey | VDBHWWZUSBIHHW-QDSKXPNFSA-N |
| XLogP | 3.24 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|